Benzene and substituted derivatives
Filtered Search Results
1,3-Dichloro-5-(chloromethyl)benzene, 97%, Thermo Scientific™
CAS: 3290-06-0 Molecular Formula: C7H5Cl3 Molecular Weight (g/mol): 195.467 InChI Key: ZFLRKAMKGYNFPH-UHFFFAOYSA-N Synonym: 3,5-dichlorobenzyl chloride,1,3-dichloro-5-chloromethyl benzene,benzene, 1,3-dichloro-5-chloromethyl,3,5-dichlorobenzylchloride,unii-c076i19eql,5-chloromethyl-1,3-dichlorobenzene,pubchem16695,alpha,3,5-trichlorotoluene,3,4-dichloro benzyl chloride,ksc495g8l PubChem CID: 137880 IUPAC Name: 1,3-dichloro-5-(chloromethyl)benzene SMILES: C1=C(C=C(C=C1Cl)Cl)CCl
| PubChem CID | 137880 |
|---|---|
| CAS | 3290-06-0 |
| Molecular Weight (g/mol) | 195.467 |
| SMILES | C1=C(C=C(C=C1Cl)Cl)CCl |
| Synonym | 3,5-dichlorobenzyl chloride,1,3-dichloro-5-chloromethyl benzene,benzene, 1,3-dichloro-5-chloromethyl,3,5-dichlorobenzylchloride,unii-c076i19eql,5-chloromethyl-1,3-dichlorobenzene,pubchem16695,alpha,3,5-trichlorotoluene,3,4-dichloro benzyl chloride,ksc495g8l |
| IUPAC Name | 1,3-dichloro-5-(chloromethyl)benzene |
| InChI Key | ZFLRKAMKGYNFPH-UHFFFAOYSA-N |
| Molecular Formula | C7H5Cl3 |
3-Methylbenzyl chloride, 98%
CAS: 620-19-9 Molecular Formula: C8H9Cl Molecular Weight (g/mol): 140.61 MDL Number: MFCD00000909 InChI Key: LZBOHNCMCCSTJX-UHFFFAOYSA-N Synonym: 3-methylbenzyl chloride,1-chloromethyl-3-methylbenzene,m-xylyl chloride,3-methylbenzylchloride,alpha-chloro-m-xylene,m-methylbenzyl chloride,1-chloromethyl-3-methyl-benzene,m-chloromethyl toluene,3-chloromethyl toluene,benzene, 1-chloromethyl-3-methyl PubChem CID: 12102 IUPAC Name: 1-(chloromethyl)-3-methylbenzene SMILES: CC1=CC(=CC=C1)CCl
| PubChem CID | 12102 |
|---|---|
| CAS | 620-19-9 |
| Molecular Weight (g/mol) | 140.61 |
| MDL Number | MFCD00000909 |
| SMILES | CC1=CC(=CC=C1)CCl |
| Synonym | 3-methylbenzyl chloride,1-chloromethyl-3-methylbenzene,m-xylyl chloride,3-methylbenzylchloride,alpha-chloro-m-xylene,m-methylbenzyl chloride,1-chloromethyl-3-methyl-benzene,m-chloromethyl toluene,3-chloromethyl toluene,benzene, 1-chloromethyl-3-methyl |
| IUPAC Name | 1-(chloromethyl)-3-methylbenzene |
| InChI Key | LZBOHNCMCCSTJX-UHFFFAOYSA-N |
| Molecular Formula | C8H9Cl |
2-Amino-5-fluorobenzamide, 97%
CAS: 63069-49-8 Molecular Formula: C7H7FN2O Molecular Weight (g/mol): 154.144 MDL Number: MFCD03428522 InChI Key: RHJMYIPLYKQZJM-UHFFFAOYSA-N PubChem CID: 10241003 IUPAC Name: 2-amino-5-fluorobenzamide SMILES: C1=CC(=C(C=C1F)C(=O)N)N
| PubChem CID | 10241003 |
|---|---|
| CAS | 63069-49-8 |
| Molecular Weight (g/mol) | 154.144 |
| MDL Number | MFCD03428522 |
| SMILES | C1=CC(=C(C=C1F)C(=O)N)N |
| IUPAC Name | 2-amino-5-fluorobenzamide |
| InChI Key | RHJMYIPLYKQZJM-UHFFFAOYSA-N |
| Molecular Formula | C7H7FN2O |
| CAS | 3724-10-5 |
|---|---|
| MDL Number | MFCD00029934 |
3-(Trifluoromethylthio)benzoic acid, 97%
CAS: 946-65-6 Molecular Formula: C8H4F3O2S Molecular Weight (g/mol): 221.17 MDL Number: MFCD00236337 InChI Key: IVGAPIVNQABETQ-UHFFFAOYSA-M Synonym: 3-trifluoromethylthio benzoic acid,3-trifluoromethyl thio benzoic acid,3-trifluoromethyl sulfanyl benzoic acid,3-trifluoromethylsulfanyl benzoic acid,3-trifluoromethylsulfanyl-benzoic acid,benzoic acid, 3-trifluoromethyl thio,3-trifluoromethyl sulphanyl benzoic acid,3-trifluoromethylthio benzoicacid,3-carboxyphenyl trifluoromethyl sulphide PubChem CID: 688330 IUPAC Name: 3-(trifluoromethylsulfanyl)benzoic acid SMILES: [O-]C(=O)C1=CC=CC(SC(F)(F)F)=C1
| PubChem CID | 688330 |
|---|---|
| CAS | 946-65-6 |
| Molecular Weight (g/mol) | 221.17 |
| MDL Number | MFCD00236337 |
| SMILES | [O-]C(=O)C1=CC=CC(SC(F)(F)F)=C1 |
| Synonym | 3-trifluoromethylthio benzoic acid,3-trifluoromethyl thio benzoic acid,3-trifluoromethyl sulfanyl benzoic acid,3-trifluoromethylsulfanyl benzoic acid,3-trifluoromethylsulfanyl-benzoic acid,benzoic acid, 3-trifluoromethyl thio,3-trifluoromethyl sulphanyl benzoic acid,3-trifluoromethylthio benzoicacid,3-carboxyphenyl trifluoromethyl sulphide |
| IUPAC Name | 3-(trifluoromethylsulfanyl)benzoic acid |
| InChI Key | IVGAPIVNQABETQ-UHFFFAOYSA-M |
| Molecular Formula | C8H4F3O2S |
Methyl thiosalicylate, 97%
CAS: 4892-02-8 Molecular Formula: C8H8O2S Molecular Weight (g/mol): 168.22 MDL Number: MFCD00060678 InChI Key: BAQGCWNPCFABAY-UHFFFAOYSA-N Synonym: methyl thiosalicylate,methyl 2-mercaptobenzoate,methyl o-mercaptobenzoate,usaf ma-15,benzoic acid, 2-mercapto-, methyl ester,methyl-o-mercaptobenzoate,methyl-2-mercaptobenzoate,benzoic acid, o-mercapto-, methyl ester,2-methoxycarbonyl thiophenol,2-mercaptobenzoic acid methyl ester PubChem CID: 21009 IUPAC Name: methyl 2-sulfanylbenzoate SMILES: COC(=O)C1=CC=CC=C1S
| PubChem CID | 21009 |
|---|---|
| CAS | 4892-02-8 |
| Molecular Weight (g/mol) | 168.22 |
| MDL Number | MFCD00060678 |
| SMILES | COC(=O)C1=CC=CC=C1S |
| Synonym | methyl thiosalicylate,methyl 2-mercaptobenzoate,methyl o-mercaptobenzoate,usaf ma-15,benzoic acid, 2-mercapto-, methyl ester,methyl-o-mercaptobenzoate,methyl-2-mercaptobenzoate,benzoic acid, o-mercapto-, methyl ester,2-methoxycarbonyl thiophenol,2-mercaptobenzoic acid methyl ester |
| IUPAC Name | methyl 2-sulfanylbenzoate |
| InChI Key | BAQGCWNPCFABAY-UHFFFAOYSA-N |
| Molecular Formula | C8H8O2S |
4-(Methylthio)benzoic acid, 97%
CAS: 13205-48-6 Molecular Formula: C8H8O2S Molecular Weight (g/mol): 168.21 MDL Number: MFCD00002555 InChI Key: KWHCPERWLHBLOT-UHFFFAOYSA-N Synonym: 4-methylthio benzoic acid,4-methylsulfanyl benzoic acid,benzoic acid, 4-methylthio,p-methylthio benzoic acid,p-methiobenzoic acid,benzoic acid, p-methylthio,4-methylthiobenzoicacid,pubchem10665,acmc-1bqaa PubChem CID: 83230 IUPAC Name: 4-methylsulfanylbenzoic acid SMILES: CSC1=CC=C(C=C1)C(O)=O
| PubChem CID | 83230 |
|---|---|
| CAS | 13205-48-6 |
| Molecular Weight (g/mol) | 168.21 |
| MDL Number | MFCD00002555 |
| SMILES | CSC1=CC=C(C=C1)C(O)=O |
| Synonym | 4-methylthio benzoic acid,4-methylsulfanyl benzoic acid,benzoic acid, 4-methylthio,p-methylthio benzoic acid,p-methiobenzoic acid,benzoic acid, p-methylthio,4-methylthiobenzoicacid,pubchem10665,acmc-1bqaa |
| IUPAC Name | 4-methylsulfanylbenzoic acid |
| InChI Key | KWHCPERWLHBLOT-UHFFFAOYSA-N |
| Molecular Formula | C8H8O2S |
Methyl 2-(methylthio)benzoate, 98%
CAS: 3704-28-7 Molecular Formula: C9H10O2S Molecular Weight (g/mol): 182.237 MDL Number: MFCD00068039 InChI Key: CPQDZXPLQXZJGF-UHFFFAOYSA-N PubChem CID: 279586 IUPAC Name: methyl 2-methylsulfanylbenzoate SMILES: COC(=O)C1=CC=CC=C1SC
| PubChem CID | 279586 |
|---|---|
| CAS | 3704-28-7 |
| Molecular Weight (g/mol) | 182.237 |
| MDL Number | MFCD00068039 |
| SMILES | COC(=O)C1=CC=CC=C1SC |
| IUPAC Name | methyl 2-methylsulfanylbenzoate |
| InChI Key | CPQDZXPLQXZJGF-UHFFFAOYSA-N |
| Molecular Formula | C9H10O2S |
Cinnamyl chloride, 95% trans
CAS: 2687-12-9 Molecular Formula: C9H9Cl Molecular Weight (g/mol): 152.62 MDL Number: MFCD00000986 InChI Key: IWTYTFSSTWXZFU-QPJJXVBHSA-N Synonym: cinnamyl chloride,3-chloroprop-1-en-1-yl benzene,3-chloro-1-phenyl-1-propene,trans-cinnamyl chloride,1e-3-chloroprop-1-en-1-yl benzene,benzene, 3-chloropropenyl,e-3-chloroprop-1-enyl benzene,unii-2i1adl56tx,2i1adl56tx,cinnamylchloride PubChem CID: 639658 IUPAC Name: [(E)-3-chloroprop-1-enyl]benzene SMILES: C1=CC=C(C=C1)C=CCCl
| PubChem CID | 639658 |
|---|---|
| CAS | 2687-12-9 |
| Molecular Weight (g/mol) | 152.62 |
| MDL Number | MFCD00000986 |
| SMILES | C1=CC=C(C=C1)C=CCCl |
| Synonym | cinnamyl chloride,3-chloroprop-1-en-1-yl benzene,3-chloro-1-phenyl-1-propene,trans-cinnamyl chloride,1e-3-chloroprop-1-en-1-yl benzene,benzene, 3-chloropropenyl,e-3-chloroprop-1-enyl benzene,unii-2i1adl56tx,2i1adl56tx,cinnamylchloride |
| IUPAC Name | [(E)-3-chloroprop-1-enyl]benzene |
| InChI Key | IWTYTFSSTWXZFU-QPJJXVBHSA-N |
| Molecular Formula | C9H9Cl |
Cinnamaldoxime, (E)+(Z), 98%
CAS: 13372-81-1 Molecular Formula: C9H9NO Molecular Weight (g/mol): 147.18 MDL Number: MFCD00019969 InChI Key: RUQDOYIAKHIMAN-DAAQNPAKSA-N Synonym: cinnamaldehyde oxime,3-phenylacrylaldehyde oxime,phenylacrylaldehyde oxime,e-n-2e-3-phenylprop-2-en-1-ylidene hydroxylamine,n-hydroxy-3-phenylprop-2-en-1-imine,n-3-phenylprop-2-en-1-ylidene hydroxylamine,3-phenylpropenal oxime,benzeneacrylaldehydeoxime,3-phenyl-2-propenal oxime,cinnamaldoxime, e + z PubChem CID: 9561350 IUPAC Name: (NE)-N-[(E)-3-phenylprop-2-enylidene]hydroxylamine SMILES: O\N=C\C=C\C1=CC=CC=C1
| PubChem CID | 9561350 |
|---|---|
| CAS | 13372-81-1 |
| Molecular Weight (g/mol) | 147.18 |
| MDL Number | MFCD00019969 |
| SMILES | O\N=C\C=C\C1=CC=CC=C1 |
| Synonym | cinnamaldehyde oxime,3-phenylacrylaldehyde oxime,phenylacrylaldehyde oxime,e-n-2e-3-phenylprop-2-en-1-ylidene hydroxylamine,n-hydroxy-3-phenylprop-2-en-1-imine,n-3-phenylprop-2-en-1-ylidene hydroxylamine,3-phenylpropenal oxime,benzeneacrylaldehydeoxime,3-phenyl-2-propenal oxime,cinnamaldoxime, e + z |
| IUPAC Name | (NE)-N-[(E)-3-phenylprop-2-enylidene]hydroxylamine |
| InChI Key | RUQDOYIAKHIMAN-DAAQNPAKSA-N |
| Molecular Formula | C9H9NO |
Cinnamyl bromide, 97%, predominantly trans
CAS: 4392-24-9 Molecular Formula: C9H9Br Molecular Weight (g/mol): 197.07 MDL Number: MFCD00000245 InChI Key: RUROFEVDCUGKHD-QPJJXVBHSA-N Synonym: cinnamyl bromide,3-bromoprop-1-en-1-yl benzene,e-3-bromoprop-1-en-1-yl benzene,3-bromo-1-phenyl-1-propene,3-bromo-1-phenyl propene-1,e-3-bromoprop-1-enyl benzene,3-bromo-propenyl-benzene,e-cinnamyl bromide,trans-cinnamyl bromide PubChem CID: 5357478 IUPAC Name: [(E)-3-bromoprop-1-enyl]benzene SMILES: C1=CC=C(C=C1)C=CCBr
| PubChem CID | 5357478 |
|---|---|
| CAS | 4392-24-9 |
| Molecular Weight (g/mol) | 197.07 |
| MDL Number | MFCD00000245 |
| SMILES | C1=CC=C(C=C1)C=CCBr |
| Synonym | cinnamyl bromide,3-bromoprop-1-en-1-yl benzene,e-3-bromoprop-1-en-1-yl benzene,3-bromo-1-phenyl-1-propene,3-bromo-1-phenyl propene-1,e-3-bromoprop-1-enyl benzene,3-bromo-propenyl-benzene,e-cinnamyl bromide,trans-cinnamyl bromide |
| IUPAC Name | [(E)-3-bromoprop-1-enyl]benzene |
| InChI Key | RUROFEVDCUGKHD-QPJJXVBHSA-N |
| Molecular Formula | C9H9Br |
4-Vinylbenzyl acetate, 95%, stabilized
CAS: 1592-12-7 Molecular Formula: C11H12O2 Molecular Weight (g/mol): 176.22 MDL Number: MFCD00078265 InChI Key: LEIKPUSDAWATBV-UHFFFAOYSA-N Synonym: 4-vinylbenzyl acetate,4-ethenylphenyl methyl acetate,4-acetoxymethylstyrene,4-vinylbenzylacetate,p-acetoxymethylstyrene,4-vinylphenyl methyl acetate,4-ethenylbenzenemethanol acetate,benzenemethanol,4-ethenyl-, 1-acetate PubChem CID: 2735161 IUPAC Name: (4-ethenylphenyl)methyl acetate SMILES: CC(=O)OCC1=CC=C(C=C)C=C1
| PubChem CID | 2735161 |
|---|---|
| CAS | 1592-12-7 |
| Molecular Weight (g/mol) | 176.22 |
| MDL Number | MFCD00078265 |
| SMILES | CC(=O)OCC1=CC=C(C=C)C=C1 |
| Synonym | 4-vinylbenzyl acetate,4-ethenylphenyl methyl acetate,4-acetoxymethylstyrene,4-vinylbenzylacetate,p-acetoxymethylstyrene,4-vinylphenyl methyl acetate,4-ethenylbenzenemethanol acetate,benzenemethanol,4-ethenyl-, 1-acetate |
| IUPAC Name | (4-ethenylphenyl)methyl acetate |
| InChI Key | LEIKPUSDAWATBV-UHFFFAOYSA-N |
| Molecular Formula | C11H12O2 |
2,5-Dimethylstyrene, 97%, stab. with 4-tert-butylcatechol
CAS: 2039-89-6 Molecular Formula: C10H12 Molecular Weight (g/mol): 132.206 MDL Number: MFCD00008614 InChI Key: DBWWINQJTZYDFK-UHFFFAOYSA-N Synonym: 2,5-dimethylstyrene,styrene, 2,5-dimethyl,1,4-dimethyl-2-vinylbenzene,1,4-dimethyl-2-ethenylbenzene,benzene, 2-ethenyl-1,4-dimethyl,unii-rtm6p5k8ca,rtm6p5k8ca,styrene,5-dimethyl,acmc-1cjqw,4-05-00-01385 beilstein handbook reference PubChem CID: 16265 IUPAC Name: 2-ethenyl-1,4-dimethylbenzene SMILES: CC1=CC(=C(C=C1)C)C=C
| PubChem CID | 16265 |
|---|---|
| CAS | 2039-89-6 |
| Molecular Weight (g/mol) | 132.206 |
| MDL Number | MFCD00008614 |
| SMILES | CC1=CC(=C(C=C1)C)C=C |
| Synonym | 2,5-dimethylstyrene,styrene, 2,5-dimethyl,1,4-dimethyl-2-vinylbenzene,1,4-dimethyl-2-ethenylbenzene,benzene, 2-ethenyl-1,4-dimethyl,unii-rtm6p5k8ca,rtm6p5k8ca,styrene,5-dimethyl,acmc-1cjqw,4-05-00-01385 beilstein handbook reference |
| IUPAC Name | 2-ethenyl-1,4-dimethylbenzene |
| InChI Key | DBWWINQJTZYDFK-UHFFFAOYSA-N |
| Molecular Formula | C10H12 |
Tris(dibenzylideneacetone)dipalladium-chloroform adduct, 97%
CAS: 52522-40-4 Molecular Formula: C52H43Cl3O3Pd2 Molecular Weight (g/mol): 1035.10 MDL Number: MFCD00075479 InChI Key: LNAMMBFJMYMQTO-UHFFFAOYSA-N Synonym: tris dibenzylideneacetone dipalladium-chloroform adduct,tris dibenylideneacetone dipalladium-chloroform,tris dibenzylideneacetone dipalladium 0 chloroform adduct,tris dibenzylideneacetone dipalladium 0-chloroform adduct,tris dibenzylideneacetone dipalladium chloroform adduct,tris dibenzylideneacetone dipalladium-chloroform,pd2 dba 3 chcl3,tris dibenzylideneacetone chloroform-di-palladium 0,tris dibenzylideneacetone dipalladium chloroform complex PubChem CID: 11029508 IUPAC Name: chloroform;(1E,4E)-1,5-diphenylpenta-1,4-dien-3-one;palladium SMILES: [Pd].[Pd].ClC(Cl)Cl.O=C(C=CC1=CC=CC=C1)C=CC1=CC=CC=C1.O=C(C=CC1=CC=CC=C1)C=CC1=CC=CC=C1.O=C(C=CC1=CC=CC=C1)C=CC1=CC=CC=C1
| PubChem CID | 11029508 |
|---|---|
| CAS | 52522-40-4 |
| Molecular Weight (g/mol) | 1035.10 |
| MDL Number | MFCD00075479 |
| SMILES | [Pd].[Pd].ClC(Cl)Cl.O=C(C=CC1=CC=CC=C1)C=CC1=CC=CC=C1.O=C(C=CC1=CC=CC=C1)C=CC1=CC=CC=C1.O=C(C=CC1=CC=CC=C1)C=CC1=CC=CC=C1 |
| Synonym | tris dibenzylideneacetone dipalladium-chloroform adduct,tris dibenylideneacetone dipalladium-chloroform,tris dibenzylideneacetone dipalladium 0 chloroform adduct,tris dibenzylideneacetone dipalladium 0-chloroform adduct,tris dibenzylideneacetone dipalladium chloroform adduct,tris dibenzylideneacetone dipalladium-chloroform,pd2 dba 3 chcl3,tris dibenzylideneacetone chloroform-di-palladium 0,tris dibenzylideneacetone dipalladium chloroform complex |
| IUPAC Name | chloroform;(1E,4E)-1,5-diphenylpenta-1,4-dien-3-one;palladium |
| InChI Key | LNAMMBFJMYMQTO-UHFFFAOYSA-N |
| Molecular Formula | C52H43Cl3O3Pd2 |